C15H27N3O — CID 144906249
(E)-2-amino-3-(methylamino)but-2-enal;N,3-dimethylaniline;ethane (PubChem CID 144906249) has the molecular formula C15H27N3O and a molecular weight of 265.40 g/mol. Its IUPAC name is (E)-2-amino-3-(methylamino)but-2-enal;N,3-dimethylaniline;ethane.
| Compound Name | (E)-2-amino-3-(methylamino)but-2-enal;N,3-dimethylaniline;ethane |
|---|---|
| PubChem CID | 144906249 |
| Molecular Formula | C15H27N3O |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.22 |
| IUPAC Name | (E)-2-amino-3-(methylamino)but-2-enal;N,3-dimethylaniline;ethane |
| SMILES | CC.CN/C(C)=C(/N)C=O.CNc1cccc(C)c1 |
| InChI | InChI=1S/C8H11N.C5H10N2O.C2H6/c1-7-4-3-5-8(6-7)9-2;1-4(7-2)5(6)3-8;1-2/h3-6,9H,1-2H3;3,7H,6H2,1-2H3;1-2H3/b;5-4+; |
| InChIKey | HFVKYAFARKVXOG-YHVJRZKVSA-N |
| XLogP | 2.66 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|