C19H20FN2+ — CID 123933002
4-(4-fluoro-2,3,5-trimethylphenyl)-3,7-dimethylquinazolin-3-ium (PubChem CID 123933002) has the molecular formula C19H20FN2+ and a molecular weight of 295.38 g/mol. Its IUPAC name is 4-(4-fluoro-2,3,5-trimethylphenyl)-3,7-dimethylquinazolin-3-ium.
| Compound Name | 4-(4-fluoro-2,3,5-trimethylphenyl)-3,7-dimethylquinazolin-3-ium |
|---|---|
| PubChem CID | 123933002 |
| Molecular Formula | C19H20FN2+ |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 4-(4-fluoro-2,3,5-trimethylphenyl)-3,7-dimethylquinazolin-3-ium |
| SMILES | Cc1ccc2c(-c3cc(C)c(F)c(C)c3C)[n+](C)cnc2c1 |
| InChI | InChI=1S/C19H20FN2/c1-11-6-7-15-17(8-11)21-10-22(5)19(15)16-9-12(2)18(20)14(4)13(16)3/h6-10H,1-5H3/q+1 |
| InChIKey | ZWLHYQSNTCSIIY-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|