C21H24FN2+ — CID 123717752
4-(4-fluoro-2-methylphenyl)-3-methyl-7-pentan-3-ylquinazolin-3-ium (PubChem CID 123717752) has the molecular formula C21H24FN2+ and a molecular weight of 323.44 g/mol. Its IUPAC name is 4-(4-fluoro-2-methylphenyl)-3-methyl-7-pentan-3-ylquinazolin-3-ium.
| Compound Name | 4-(4-fluoro-2-methylphenyl)-3-methyl-7-pentan-3-ylquinazolin-3-ium |
|---|---|
| PubChem CID | 123717752 |
| Molecular Formula | C21H24FN2+ |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | 4-(4-fluoro-2-methylphenyl)-3-methyl-7-pentan-3-ylquinazolin-3-ium |
| SMILES | CCC(CC)c1ccc2c(-c3ccc(F)cc3C)[n+](C)cnc2c1 |
| InChI | InChI=1S/C21H24FN2/c1-5-15(6-2)16-7-9-19-20(12-16)23-13-24(4)21(19)18-10-8-17(22)11-14(18)3/h7-13,15H,5-6H2,1-4H3/q+1 |
| InChIKey | NJDGFFKOMOWNKK-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|