C23H27FN+ — CID 157280383
1-(4-fluoro-2,3,5-trimethylphenyl)-2,3-dimethyl-5-propan-2-ylisoquinolin-2-ium (PubChem CID 157280383) has the molecular formula C23H27FN+ and a molecular weight of 336.47 g/mol. Its IUPAC name is 1-(4-fluoro-2,3,5-trimethylphenyl)-2,3-dimethyl-5-propan-2-ylisoquinolin-2-ium.
| Compound Name | 1-(4-fluoro-2,3,5-trimethylphenyl)-2,3-dimethyl-5-propan-2-ylisoquinolin-2-ium |
|---|---|
| PubChem CID | 157280383 |
| Molecular Formula | C23H27FN+ |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | 1-(4-fluoro-2,3,5-trimethylphenyl)-2,3-dimethyl-5-propan-2-ylisoquinolin-2-ium |
| SMILES | Cc1cc(-c2c3cccc(C(C)C)c3cc(C)[n+]2C)c(C)c(C)c1F |
| InChI | InChI=1S/C23H27FN/c1-13(2)18-9-8-10-19-21(18)12-15(4)25(7)23(19)20-11-14(3)22(24)17(6)16(20)5/h8-13H,1-7H3/q+1 |
| InChIKey | GCTOCGNUFMIUJF-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|