C49H55FN2+2 — CID 170384578
2-(2,5-dimethylphenyl)-6-fluoro-1-methyl-5-[4-[4-[1-methyl-2-(2,3,5-trimethylphenyl)quinolin-1-ium-7-yl]cyclohexyl]cyclohexyl]quinolin-1-ium (PubChem CID 170384578) has the molecular formula C49H55FN2+2 and a molecular weight of 690.99 g/mol. Its IUPAC name is 2-(2,5-dimethylphenyl)-6-fluoro-1-methyl-5-[4-[4-[1-methyl-2-(2,3,5-trimethylphenyl)quinolin-1-ium-7-yl]cyclohexyl]cyclohexyl]quinolin-1-ium.
| Compound Name | 2-(2,5-dimethylphenyl)-6-fluoro-1-methyl-5-[4-[4-[1-methyl-2-(2,3,5-trimethylphenyl)quinolin-1-ium-7-yl]cyclohexyl]cyclohexyl]quinolin-1-ium |
|---|---|
| PubChem CID | 170384578 |
| Molecular Formula | C49H55FN2+2 |
| Molecular Weight | 690.99 g/mol |
| Exact Mass | 690.43 |
| IUPAC Name | 2-(2,5-dimethylphenyl)-6-fluoro-1-methyl-5-[4-[4-[1-methyl-2-(2,3,5-trimethylphenyl)quinolin-1-ium-7-yl]cyclohexyl]cyclohexyl]quinolin-1-ium |
| SMILES | Cc1ccc(C)c(-c2ccc3c(C4CCC(C5CCC(c6ccc7ccc(-c8cc(C)cc(C)c8C)[n+](C)c7c6)CC5)CC4)c(F)ccc3[n+]2C)c1 |
| InChI | InChI=1S/C49H55FN2/c1-30-8-9-32(3)42(27-30)46-24-21-41-45(51(46)6)25-22-44(50)49(41)39-17-14-36(15-18-39)35-10-12-37(13-11-35)40-19-16-38-20-23-47(52(7)48(38)29-40)43-28-31(2)26-33(4)34(43)5/h8-9,16,19-29,35-37,39H,10-15,17-18H2,1-7H3/q+2 |
| InChIKey | NFEYKEOSFIZDMW-UHFFFAOYSA-N |
| XLogP | 11.90 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.99 |
| LogP ≤ 5 | 11.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|