C23H25FN+ — CID 123844364
5-cyclopentyl-2-(2,5-dimethylphenyl)-6-fluoro-1-methylquinolin-1-ium (PubChem CID 123844364) has the molecular formula C23H25FN+ and a molecular weight of 334.46 g/mol. Its IUPAC name is 5-cyclopentyl-2-(2,5-dimethylphenyl)-6-fluoro-1-methylquinolin-1-ium.
| Compound Name | 5-cyclopentyl-2-(2,5-dimethylphenyl)-6-fluoro-1-methylquinolin-1-ium |
|---|---|
| PubChem CID | 123844364 |
| Molecular Formula | C23H25FN+ |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | 5-cyclopentyl-2-(2,5-dimethylphenyl)-6-fluoro-1-methylquinolin-1-ium |
| SMILES | Cc1ccc(C)c(-c2ccc3c(C4CCCC4)c(F)ccc3[n+]2C)c1 |
| InChI | InChI=1S/C23H25FN/c1-15-8-9-16(2)19(14-15)22-12-10-18-21(25(22)3)13-11-20(24)23(18)17-6-4-5-7-17/h8-14,17H,4-7H2,1-3H3/q+1 |
| InChIKey | KPGFSMNXCLSTOX-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|