C30H27N2O+ — CID 159456618
8,14-dimethyl-9-[2-methyl-6-(1,1,1,2-tetradeuteriopropan-2-yl)isoquinolin-2-ium-1-yl]-11-oxa-13-azatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,12(17),13,15-octaene (PubChem CID 159456618) has the molecular formula C30H27N2O+ and a molecular weight of 435.58 g/mol. Its IUPAC name is 8,14-dimethyl-9-[2-methyl-6-(1,1,1,2-tetradeuteriopropan-2-yl)isoquinolin-2-ium-1-yl]-11-oxa-13-azatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,12(17),13,15-octaene.
| Compound Name | 8,14-dimethyl-9-[2-methyl-6-(1,1,1,2-tetradeuteriopropan-2-yl)isoquinolin-2-ium-1-yl]-11-oxa-13-azatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,12(17),13,15-octaene |
|---|---|
| PubChem CID | 159456618 |
| Molecular Formula | C30H27N2O+ |
| Molecular Weight | 435.58 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | 8,14-dimethyl-9-[2-methyl-6-(1,1,1,2-tetradeuteriopropan-2-yl)isoquinolin-2-ium-1-yl]-11-oxa-13-azatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,12(17),13,15-octaene |
| SMILES | [2H]C([2H])([2H])C([2H])(C)c1ccc2c(-c3c(C)c4ccccc4c4c3oc3nc(C)ccc34)[n+](C)ccc2c1 |
| InChI | InChI=1S/C30H27N2O/c1-17(2)20-11-13-23-21(16-20)14-15-32(5)28(23)26-19(4)22-8-6-7-9-24(22)27-25-12-10-18(3)31-30(25)33-29(26)27/h6-17H,1-5H3/q+1/i1D3,17D |
| InChIKey | ZTIKGCNDRUUTBQ-LCJPYDMBSA-N |
| XLogP | 7.52 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.58 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|