C29H29N2O+ — CID 157319331
9-[4-(1-deuteriocyclohexyl)-1-methylpyridin-1-ium-2-yl]-8,14-dimethyl-11-oxa-13-azatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,12(17),13,15-octaene (PubChem CID 157319331) has the molecular formula C29H29N2O+ and a molecular weight of 422.57 g/mol. Its IUPAC name is 9-[4-(1-deuteriocyclohexyl)-1-methylpyridin-1-ium-2-yl]-8,14-dimethyl-11-oxa-13-azatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,12(17),13,15-octaene.
| Compound Name | 9-[4-(1-deuteriocyclohexyl)-1-methylpyridin-1-ium-2-yl]-8,14-dimethyl-11-oxa-13-azatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,12(17),13,15-octaene |
|---|---|
| PubChem CID | 157319331 |
| Molecular Formula | C29H29N2O+ |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | 9-[4-(1-deuteriocyclohexyl)-1-methylpyridin-1-ium-2-yl]-8,14-dimethyl-11-oxa-13-azatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,12(17),13,15-octaene |
| SMILES | [2H]C1(c2cc[n+](C)c(-c3c(C)c4ccccc4c4c3oc3nc(C)ccc34)c2)CCCCC1 |
| InChI | InChI=1S/C29H29N2O/c1-18-13-14-24-27-23-12-8-7-11-22(23)19(2)26(28(27)32-29(24)30-18)25-17-21(15-16-31(25)3)20-9-5-4-6-10-20/h7-8,11-17,20H,4-6,9-10H2,1-3H3/q+1/i20D |
| InChIKey | CRTCWPAGIXYQHE-YVHRXSIGSA-N |
| XLogP | 7.29 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|