C24H23N2O+ — CID 167377378
5-(1-deuteriocyclohexyl)-17-(trideuteriomethyl)-20-oxa-18-aza-8-azoniapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3(8),4,6,11,14(19),15,17-nonaene (PubChem CID 167377378) has the molecular formula C24H23N2O+ and a molecular weight of 359.49 g/mol. Its IUPAC name is 5-(1-deuteriocyclohexyl)-17-(trideuteriomethyl)-20-oxa-18-aza-8-azoniapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3(8),4,6,11,14(19),15,17-nonaene.
| Compound Name | 5-(1-deuteriocyclohexyl)-17-(trideuteriomethyl)-20-oxa-18-aza-8-azoniapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3(8),4,6,11,14(19),15,17-nonaene |
|---|---|
| PubChem CID | 167377378 |
| Molecular Formula | C24H23N2O+ |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | 5-(1-deuteriocyclohexyl)-17-(trideuteriomethyl)-20-oxa-18-aza-8-azoniapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3(8),4,6,11,14(19),15,17-nonaene |
| SMILES | [2H]C([2H])([2H])c1ccc2c(n1)oc1c3c(ccc12)C[n+]1ccc(C2([2H])CCCCC2)cc1-3 |
| InChI | InChI=1S/C24H23N2O/c1-15-7-9-20-19-10-8-18-14-26-12-11-17(16-5-3-2-4-6-16)13-21(26)22(18)23(19)27-24(20)25-15/h7-13,16H,2-6,14H2,1H3/q+1/i1D3,16D |
| InChIKey | DBJWRAWJSOTEEU-KFHHUZHISA-N |
| XLogP | 5.65 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|