C28H27N2O+ — CID 140828108
8-[4-(1-deuteriocyclohexyl)-1-methylpyridin-1-ium-2-yl]-9-methyl-[1]benzofuro[2,3-c]isoquinoline (PubChem CID 140828108) has the molecular formula C28H27N2O+ and a molecular weight of 408.54 g/mol. Its IUPAC name is 8-[4-(1-deuteriocyclohexyl)-1-methylpyridin-1-ium-2-yl]-9-methyl-[1]benzofuro[2,3-c]isoquinoline.
| Compound Name | 8-[4-(1-deuteriocyclohexyl)-1-methylpyridin-1-ium-2-yl]-9-methyl-[1]benzofuro[2,3-c]isoquinoline |
|---|---|
| PubChem CID | 140828108 |
| Molecular Formula | C28H27N2O+ |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 8-[4-(1-deuteriocyclohexyl)-1-methylpyridin-1-ium-2-yl]-9-methyl-[1]benzofuro[2,3-c]isoquinoline |
| SMILES | [2H]C1(c2cc[n+](C)c(-c3c(C)ccc4c3oc3ncc5ccccc5c34)c2)CCCCC1 |
| InChI | InChI=1S/C28H27N2O/c1-18-12-13-23-26-22-11-7-6-10-21(22)17-29-28(26)31-27(23)25(18)24-16-20(14-15-30(24)2)19-8-4-3-5-9-19/h6-7,10-17,19H,3-5,8-9H2,1-2H3/q+1/i19D |
| InChIKey | TUCHIJANJQEYQW-YUIGOLOMSA-N |
| XLogP | 6.98 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|