C20H17N2O+ — CID 167377400
5,6,17-tris(trideuteriomethyl)-20-oxa-18-aza-8-azoniapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3(8),4,6,11,14(19),15,17-nonaene (PubChem CID 167377400) has the molecular formula C20H17N2O+ and a molecular weight of 310.42 g/mol. Its IUPAC name is 5,6,17-tris(trideuteriomethyl)-20-oxa-18-aza-8-azoniapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3(8),4,6,11,14(19),15,17-nonaene.
| Compound Name | 5,6,17-tris(trideuteriomethyl)-20-oxa-18-aza-8-azoniapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3(8),4,6,11,14(19),15,17-nonaene |
|---|---|
| PubChem CID | 167377400 |
| Molecular Formula | C20H17N2O+ |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | 5,6,17-tris(trideuteriomethyl)-20-oxa-18-aza-8-azoniapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3(8),4,6,11,14(19),15,17-nonaene |
| SMILES | [2H]C([2H])([2H])c1ccc2c(n1)oc1c3c(ccc12)C[n+]1cc(C([2H])([2H])[2H])c(C([2H])([2H])[2H])cc1-3 |
| InChI | InChI=1S/C20H17N2O/c1-11-8-17-18-14(10-22(17)9-12(11)2)5-7-15-16-6-4-13(3)21-20(16)23-19(15)18/h4-9H,10H2,1-3H3/q+1/i1D3,2D3,3D3 |
| InChIKey | QXWIGJPCDIGHHO-GQALSZNTSA-N |
| XLogP | 4.22 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|