About CID 176956309
CID 176956309 (PubChem CID 176956309) has the molecular formula C43H51BN3O+
and a molecular weight of 636.71 g/mol.
Molecular Properties
| Compound Name | CID 176956309 |
| PubChem CID | 176956309 |
| Molecular Formula | C43H51BN3O+ |
| Molecular Weight | 636.71 g/mol |
| Exact Mass | 636.41 |
| IUPAC Name | — |
| SMILES | CC#CC1CC=CC=C1/C(C)=N/C=C\C.CCC(C)C.[B]C1(c2cc[n+]3c(c2)-c2c(ccc4c2oc2nc(C)ccc24)C3)CCCCC1 |
| InChI | InChI=1S/C24H22BN2O.C14H17N.C5H12/c1-15-5-7-19-18-8-6-16-14-27-12-9-17(24(25)10-3-2-4-11-24)13-20(27)21(16)22(18)28-23(19)26-15;1-4-8-13-9-6-7-10-14(13)12(3)15-11-5-2;1-4-5(2)3/h5-9,12-13H,2-4,10-11,14H2,1H3;5-7,10-11,13H,9H2,1-3H3;5H,4H2,1-3H3/q+1;;/b;11-5-,15-12+; |
| InChIKey | NXFAPVHLHIDGHT-ZUGODRQKSA-N |
| XLogP | 10.49 |
| TPSA | 42.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 636.71 |
| LogP ≤ 5 | 10.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 176956309 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 176956309?
The IUPAC name of CID 176956309 (CID 176956309) is not available.
What is the SMILES notation for CID 176956309?
The canonical SMILES for CID 176956309 is CC#CC1CC=CC=C1/C(C)=N/C=C\C.CCC(C)C.[B]C1(c2cc[n+]3c(c2)-c2c(ccc4c2oc2nc(C)ccc24)C3)CCCCC1.
What is the InChIKey of CID 176956309?
The InChIKey is NXFAPVHLHIDGHT-ZUGODRQKSA-N. The full InChI is InChI=1S/C24H22BN2O.C14H17N.C5H12/c1-15-5-7-19-18-8-6-16-14-27-12-9-17(24(25)10-3-2-4-11-24)13-20(27)21(16)22(18)28-23(19)26-15;1-4-8-13-9-6-7-10-14(13)12(3)15-11-5-2;1-4-5(2)3/h5-9,12-13H,2-4,10-11,14H2,1H3;5-7,10-11,13H,9H2,1-3H3;5H,4H2,1-3H3/q+1;;/b;11-5-,15-12+;.
What are the key properties of CID 176956309?
CID 176956309 has a molecular weight of 636.71 g/mol, XLogP of 10.49, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 176956309 is sourced from PubChem (CID 176956309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).