C43H51BN3O+ — CID 176956309
CID 176956309 (PubChem CID 176956309) has the molecular formula C43H51BN3O+ and a molecular weight of 636.71 g/mol.
| Compound Name | CID 176956309 |
|---|---|
| PubChem CID | 176956309 |
| Molecular Formula | C43H51BN3O+ |
| Molecular Weight | 636.71 g/mol |
| Exact Mass | 636.41 |
| IUPAC Name | — |
| SMILES | CC#CC1CC=CC=C1/C(C)=N/C=C\C.CCC(C)C.[B]C1(c2cc[n+]3c(c2)-c2c(ccc4c2oc2nc(C)ccc24)C3)CCCCC1 |
| InChI | InChI=1S/C24H22BN2O.C14H17N.C5H12/c1-15-5-7-19-18-8-6-16-14-27-12-9-17(24(25)10-3-2-4-11-24)13-20(27)21(16)22(18)28-23(19)26-15;1-4-8-13-9-6-7-10-14(13)12(3)15-11-5-2;1-4-5(2)3/h5-9,12-13H,2-4,10-11,14H2,1H3;5-7,10-11,13H,9H2,1-3H3;5H,4H2,1-3H3/q+1;;/b;11-5-,15-12+; |
| InChIKey | NXFAPVHLHIDGHT-ZUGODRQKSA-N |
| XLogP | 10.49 |
| TPSA | 42.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.71 |
| LogP ≤ 5 | 10.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|