C33H31N3O — CID 176787855
3-[6-(2,6-ditert-butylpyrimidin-4-yl)dibenzofuran-4-yl]isoquinoline (PubChem CID 176787855) has the molecular formula C33H31N3O and a molecular weight of 485.63 g/mol. Its IUPAC name is 3-[6-(2,6-ditert-butylpyrimidin-4-yl)dibenzofuran-4-yl]isoquinoline.
| Compound Name | 3-[6-(2,6-ditert-butylpyrimidin-4-yl)dibenzofuran-4-yl]isoquinoline |
|---|---|
| PubChem CID | 176787855 |
| Molecular Formula | C33H31N3O |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.25 |
| IUPAC Name | 3-[6-(2,6-ditert-butylpyrimidin-4-yl)dibenzofuran-4-yl]isoquinoline |
| SMILES | CC(C)(C)c1cc(-c2cccc3c2oc2c(-c4cc5ccccc5cn4)cccc23)nc(C(C)(C)C)n1 |
| InChI | InChI=1S/C33H31N3O/c1-32(2,3)28-18-27(35-31(36-28)33(4,5)6)25-16-10-14-23-22-13-9-15-24(29(22)37-30(23)25)26-17-20-11-7-8-12-21(20)19-34-26/h7-19H,1-6H3 |
| InChIKey | UJIDMGHGKFQPEI-UHFFFAOYSA-N |
| XLogP | 8.85 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |