C45H42N4O — CID 166496399
2,4-ditert-butyl-6-[3,5-dimethyl-4-[5-methyl-2-(3-oxapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(13),2(10),4(9),5,7,11,14,16,18,20-decaen-5-yl)-4-pyridinyl]phenyl]-1,3,5-triazine (PubChem CID 166496399) has the molecular formula C45H42N4O and a molecular weight of 654.86 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[3,5-dimethyl-4-[5-methyl-2-(3-oxapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(13),2(10),4(9),5,7,11,14,16,18,20-decaen-5-yl)-4-pyridinyl]phenyl]-1,3,5-triazine.
| Compound Name | 2,4-ditert-butyl-6-[3,5-dimethyl-4-[5-methyl-2-(3-oxapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(13),2(10),4(9),5,7,11,14,16,18,20-decaen-5-yl)-4-pyridinyl]phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 166496399 |
| Molecular Formula | C45H42N4O |
| Molecular Weight | 654.86 g/mol |
| Exact Mass | 654.34 |
| IUPAC Name | 2,4-ditert-butyl-6-[3,5-dimethyl-4-[5-methyl-2-(3-oxapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(13),2(10),4(9),5,7,11,14,16,18,20-decaen-5-yl)-4-pyridinyl]phenyl]-1,3,5-triazine |
| SMILES | Cc1cnc(-c2cccc3c2oc2c3ccc3ccc4ccccc4c32)cc1-c1c(C)cc(-c2nc(C(C)(C)C)nc(C(C)(C)C)n2)cc1C |
| InChI | InChI=1S/C45H42N4O/c1-25-21-30(41-47-42(44(4,5)6)49-43(48-41)45(7,8)9)22-26(2)37(25)35-23-36(46-24-27(35)3)34-16-12-15-32-33-20-19-29-18-17-28-13-10-11-14-31(28)38(29)40(33)50-39(32)34/h10-24H,1-9H3 |
| InChIKey | DUQSZYRUDCGDKS-UHFFFAOYSA-N |
| XLogP | 11.99 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.86 |
| LogP ≤ 5 | 11.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|