C36H37N2O+ — CID 176787558
2-[6-(4,6-ditert-butyl-2-pyridinyl)-3-methyldibenzofuran-4-yl]-1-methylquinolin-1-ium (PubChem CID 176787558) has the molecular formula C36H37N2O+ and a molecular weight of 513.71 g/mol. Its IUPAC name is 2-[6-(4,6-ditert-butyl-2-pyridinyl)-3-methyldibenzofuran-4-yl]-1-methylquinolin-1-ium.
| Compound Name | 2-[6-(4,6-ditert-butyl-2-pyridinyl)-3-methyldibenzofuran-4-yl]-1-methylquinolin-1-ium |
|---|---|
| PubChem CID | 176787558 |
| Molecular Formula | C36H37N2O+ |
| Molecular Weight | 513.71 g/mol |
| Exact Mass | 513.29 |
| IUPAC Name | 2-[6-(4,6-ditert-butyl-2-pyridinyl)-3-methyldibenzofuran-4-yl]-1-methylquinolin-1-ium |
| SMILES | Cc1ccc2c(oc3c(-c4cc(C(C)(C)C)cc(C(C)(C)C)n4)cccc32)c1-c1ccc2ccccc2[n+]1C |
| InChI | InChI=1S/C36H37N2O/c1-22-16-18-26-25-13-11-14-27(28-20-24(35(2,3)4)21-31(37-28)36(5,6)7)33(25)39-34(26)32(22)30-19-17-23-12-9-10-15-29(23)38(30)8/h9-21H,1-8H3/q+1 |
| InChIKey | NJXWBRYFYBITNG-UHFFFAOYSA-N |
| XLogP | 9.20 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.71 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|