C39H29F2NO — CID 170152904
5-tert-butyl-4-fluoro-2-[7-fluoro-6-[4-(4-phenylphenyl)phenyl]dibenzofuran-4-yl]pyridine (PubChem CID 170152904) has the molecular formula C39H29F2NO and a molecular weight of 565.66 g/mol. Its IUPAC name is 5-tert-butyl-4-fluoro-2-[7-fluoro-6-[4-(4-phenylphenyl)phenyl]dibenzofuran-4-yl]pyridine.
| Compound Name | 5-tert-butyl-4-fluoro-2-[7-fluoro-6-[4-(4-phenylphenyl)phenyl]dibenzofuran-4-yl]pyridine |
|---|---|
| PubChem CID | 170152904 |
| Molecular Formula | C39H29F2NO |
| Molecular Weight | 565.66 g/mol |
| Exact Mass | 565.22 |
| IUPAC Name | 5-tert-butyl-4-fluoro-2-[7-fluoro-6-[4-(4-phenylphenyl)phenyl]dibenzofuran-4-yl]pyridine |
| SMILES | CC(C)(C)c1cnc(-c2cccc3c2oc2c(-c4ccc(-c5ccc(-c6ccccc6)cc5)cc4)c(F)ccc23)cc1F |
| InChI | InChI=1S/C39H29F2NO/c1-39(2,3)32-23-42-35(22-34(32)41)31-11-7-10-29-30-20-21-33(40)36(38(30)43-37(29)31)28-18-16-27(17-19-28)26-14-12-25(13-15-26)24-8-5-4-6-9-24/h4-23H,1-3H3 |
| InChIKey | HVQHLFBFVHYJQS-UHFFFAOYSA-N |
| XLogP | 11.22 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.66 |
| LogP ≤ 5 | 11.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |