C28H33N2+ — CID 140636161
1-tert-butyl-2-(2-tert-butyl-4-methylphenyl)-3-phenylbenzimidazol-1-ium (PubChem CID 140636161) has the molecular formula C28H33N2+ and a molecular weight of 397.59 g/mol. Its IUPAC name is 1-tert-butyl-2-(2-tert-butyl-4-methylphenyl)-3-phenylbenzimidazol-1-ium.
| Compound Name | 1-tert-butyl-2-(2-tert-butyl-4-methylphenyl)-3-phenylbenzimidazol-1-ium |
|---|---|
| PubChem CID | 140636161 |
| Molecular Formula | C28H33N2+ |
| Molecular Weight | 397.59 g/mol |
| Exact Mass | 397.26 |
| IUPAC Name | 1-tert-butyl-2-(2-tert-butyl-4-methylphenyl)-3-phenylbenzimidazol-1-ium |
| SMILES | Cc1ccc(-c2n(-c3ccccc3)c3ccccc3[n+]2C(C)(C)C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C28H33N2/c1-20-17-18-22(23(19-20)27(2,3)4)26-29(21-13-9-8-10-14-21)24-15-11-12-16-25(24)30(26)28(5,6)7/h8-19H,1-7H3/q+1 |
| InChIKey | KIUBVIJEGRKSLO-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.59 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|