C34H36N3S+ — CID 140847284
1-[2,4-di(propan-2-yl)dibenzothiophen-3-yl]-3,5,6-trimethyl-2-(4-methyl-3-pyridinyl)benzimidazol-3-ium (PubChem CID 140847284) has the molecular formula C34H36N3S+ and a molecular weight of 518.75 g/mol. Its IUPAC name is 1-[2,4-di(propan-2-yl)dibenzothiophen-3-yl]-3,5,6-trimethyl-2-(4-methyl-3-pyridinyl)benzimidazol-3-ium.
| Compound Name | 1-[2,4-di(propan-2-yl)dibenzothiophen-3-yl]-3,5,6-trimethyl-2-(4-methyl-3-pyridinyl)benzimidazol-3-ium |
|---|---|
| PubChem CID | 140847284 |
| Molecular Formula | C34H36N3S+ |
| Molecular Weight | 518.75 g/mol |
| Exact Mass | 518.26 |
| IUPAC Name | 1-[2,4-di(propan-2-yl)dibenzothiophen-3-yl]-3,5,6-trimethyl-2-(4-methyl-3-pyridinyl)benzimidazol-3-ium |
| SMILES | Cc1cc2c(cc1C)[n+](C)c(-c1cnccc1C)n2-c1c(C(C)C)cc2c(sc3ccccc32)c1C(C)C |
| InChI | InChI=1S/C34H36N3S/c1-19(2)25-17-26-24-11-9-10-12-30(24)38-33(26)31(20(3)4)32(25)37-29-16-23(7)22(6)15-28(29)36(8)34(37)27-18-35-14-13-21(27)5/h9-20H,1-8H3/q+1 |
| InChIKey | DFCLLGDIYBGALU-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.75 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|