C47H44N3O+ — CID 176823840
7,20,20-trimethyl-8-[1-methyl-3-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazol-1-ium-2-yl]-10-oxa-2-azapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1,3(11),4(9),5,7,12,14,16,18-nonaene (PubChem CID 176823840) has the molecular formula C47H44N3O+ and a molecular weight of 666.89 g/mol. Its IUPAC name is 7,20,20-trimethyl-8-[1-methyl-3-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazol-1-ium-2-yl]-10-oxa-2-azapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1,3(11),4(9),5,7,12,14,16,18-nonaene.
| Compound Name | 7,20,20-trimethyl-8-[1-methyl-3-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazol-1-ium-2-yl]-10-oxa-2-azapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1,3(11),4(9),5,7,12,14,16,18-nonaene |
|---|---|
| PubChem CID | 176823840 |
| Molecular Formula | C47H44N3O+ |
| Molecular Weight | 666.89 g/mol |
| Exact Mass | 666.35 |
| IUPAC Name | 7,20,20-trimethyl-8-[1-methyl-3-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazol-1-ium-2-yl]-10-oxa-2-azapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1,3(11),4(9),5,7,12,14,16,18-nonaene |
| SMILES | Cc1ccc2c(oc3cc4c(nc32)C(C)(C)c2ccccc2-4)c1-c1n(-c2c(C(C)C)cc(-c3ccccc3)cc2C(C)C)c2ccccc2[n+]1C |
| InChI | InChI=1S/C47H44N3O/c1-27(2)34-24-31(30-16-10-9-11-17-30)25-35(28(3)4)43(34)50-39-21-15-14-20-38(39)49(8)46(50)41-29(5)22-23-33-42-40(51-44(33)41)26-36-32-18-12-13-19-37(32)47(6,7)45(36)48-42/h9-28H,1-8H3/q+1 |
| InChIKey | BZPUELGARVGSJE-UHFFFAOYSA-N |
| XLogP | 11.94 |
| TPSA | 34.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.89 |
| LogP ≤ 5 | 11.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|