C46H40N3O+ — CID 167388134
8-methyl-9-[1-methyl-3-[4-(4-phenylphenyl)-2,6-di(propan-2-yl)phenyl]benzimidazol-1-ium-2-yl]dibenzofuran-3-carbonitrile (PubChem CID 167388134) has the molecular formula C46H40N3O+ and a molecular weight of 650.85 g/mol. Its IUPAC name is 8-methyl-9-[1-methyl-3-[4-(4-phenylphenyl)-2,6-di(propan-2-yl)phenyl]benzimidazol-1-ium-2-yl]dibenzofuran-3-carbonitrile.
| Compound Name | 8-methyl-9-[1-methyl-3-[4-(4-phenylphenyl)-2,6-di(propan-2-yl)phenyl]benzimidazol-1-ium-2-yl]dibenzofuran-3-carbonitrile |
|---|---|
| PubChem CID | 167388134 |
| Molecular Formula | C46H40N3O+ |
| Molecular Weight | 650.85 g/mol |
| Exact Mass | 650.32 |
| IUPAC Name | 8-methyl-9-[1-methyl-3-[4-(4-phenylphenyl)-2,6-di(propan-2-yl)phenyl]benzimidazol-1-ium-2-yl]dibenzofuran-3-carbonitrile |
| SMILES | Cc1ccc2oc3cc(C#N)ccc3c2c1-c1n(-c2c(C(C)C)cc(-c3ccc(-c4ccccc4)cc3)cc2C(C)C)c2ccccc2[n+]1C |
| InChI | InChI=1S/C46H40N3O/c1-28(2)37-25-35(34-20-18-33(19-21-34)32-12-8-7-9-13-32)26-38(29(3)4)45(37)49-40-15-11-10-14-39(40)48(6)46(49)43-30(5)16-23-41-44(43)36-22-17-31(27-47)24-42(36)50-41/h7-26,28-29H,1-6H3/q+1 |
| InChIKey | NUVMAHARMGYDMK-UHFFFAOYSA-N |
| XLogP | 11.78 |
| TPSA | 45.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.85 |
| LogP ≤ 5 | 11.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|