C27H25N2+ — CID 123974554
6,9,9-trimethyl-7-(1-methyl-4-phenylpyridin-1-ium-2-yl)indeno[2,1-b]pyridine (PubChem CID 123974554) has the molecular formula C27H25N2+ and a molecular weight of 377.51 g/mol. Its IUPAC name is 6,9,9-trimethyl-7-(1-methyl-4-phenylpyridin-1-ium-2-yl)indeno[2,1-b]pyridine.
| Compound Name | 6,9,9-trimethyl-7-(1-methyl-4-phenylpyridin-1-ium-2-yl)indeno[2,1-b]pyridine |
|---|---|
| PubChem CID | 123974554 |
| Molecular Formula | C27H25N2+ |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 6,9,9-trimethyl-7-(1-methyl-4-phenylpyridin-1-ium-2-yl)indeno[2,1-b]pyridine |
| SMILES | Cc1cc2c(cc1-c1cc(-c3ccccc3)cc[n+]1C)C(C)(C)c1ncccc1-2 |
| InChI | InChI=1S/C27H25N2/c1-18-15-23-21-11-8-13-28-26(21)27(2,3)24(23)17-22(18)25-16-20(12-14-29(25)4)19-9-6-5-7-10-19/h5-17H,1-4H3/q+1 |
| InChIKey | IWPVJRACSZSLGC-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|