About 4-[4-(4,4-dimethylcyclohexyl)phenyl]-1-methyl-2-(2-methylphenyl)pyridin-1-ium
4-[4-(4,4-dimethylcyclohexyl)phenyl]-1-methyl-2-(2-methylphenyl)pyridin-1-ium (PubChem CID 140777994) has the molecular formula C27H32N+
and a molecular weight of 370.56 g/mol. Its IUPAC name is 4-[4-(4,4-dimethylcyclohexyl)phenyl]-1-methyl-2-(2-methylphenyl)pyridin-1-ium.
Molecular Properties
| Compound Name | 4-[4-(4,4-dimethylcyclohexyl)phenyl]-1-methyl-2-(2-methylphenyl)pyridin-1-ium |
| PubChem CID | 140777994 |
| Molecular Formula | C27H32N+ |
| Molecular Weight | 370.56 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | 4-[4-(4,4-dimethylcyclohexyl)phenyl]-1-methyl-2-(2-methylphenyl)pyridin-1-ium |
| SMILES | Cc1ccccc1-c1cc(-c2ccc(C3CCC(C)(C)CC3)cc2)cc[n+]1C |
| InChI | InChI=1S/C27H32N/c1-20-7-5-6-8-25(20)26-19-24(15-18-28(26)4)22-11-9-21(10-12-22)23-13-16-27(2,3)17-14-23/h5-12,15,18-19,23H,13-14,16-17H2,1-4H3/q+1 |
| InChIKey | HLPABRLCVPJFIR-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.56 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-(4,4-dimethylcyclohexyl)phenyl]-1-methyl-2-(2-methylphenyl)pyridin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(4,4-dimethylcyclohexyl)phenyl]-1-methyl-2-(2-methylphenyl)pyridin-1-ium?
The IUPAC name of 4-[4-(4,4-dimethylcyclohexyl)phenyl]-1-methyl-2-(2-methylphenyl)pyridin-1-ium (CID 140777994) is 4-[4-(4,4-dimethylcyclohexyl)phenyl]-1-methyl-2-(2-methylphenyl)pyridin-1-ium.
What is the SMILES notation for 4-[4-(4,4-dimethylcyclohexyl)phenyl]-1-methyl-2-(2-methylphenyl)pyridin-1-ium?
The canonical SMILES for 4-[4-(4,4-dimethylcyclohexyl)phenyl]-1-methyl-2-(2-methylphenyl)pyridin-1-ium is Cc1ccccc1-c1cc(-c2ccc(C3CCC(C)(C)CC3)cc2)cc[n+]1C.
What is the InChIKey of 4-[4-(4,4-dimethylcyclohexyl)phenyl]-1-methyl-2-(2-methylphenyl)pyridin-1-ium?
The InChIKey is HLPABRLCVPJFIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H32N/c1-20-7-5-6-8-25(20)26-19-24(15-18-28(26)4)22-11-9-21(10-12-22)23-13-16-27(2,3)17-14-23/h5-12,15,18-19,23H,13-14,16-17H2,1-4H3/q+1.
What are the key properties of 4-[4-(4,4-dimethylcyclohexyl)phenyl]-1-methyl-2-(2-methylphenyl)pyridin-1-ium?
4-[4-(4,4-dimethylcyclohexyl)phenyl]-1-methyl-2-(2-methylphenyl)pyridin-1-ium has a molecular weight of 370.56 g/mol, XLogP of 6.84, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(4,4-dimethylcyclohexyl)phenyl]-1-methyl-2-(2-methylphenyl)pyridin-1-ium is sourced from PubChem (CID 140777994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).