C29H30NSi+ — CID 166503326
2-[5-(5,5-dimethylbenzo[b][1]benzosilol-3-yl)-2-methyl-4-(trideuteriomethyl)phenyl]-1-methyl-5-(trideuteriomethyl)pyridin-1-ium (PubChem CID 166503326) has the molecular formula C29H30NSi+ and a molecular weight of 426.69 g/mol. Its IUPAC name is 2-[5-(5,5-dimethylbenzo[b][1]benzosilol-3-yl)-2-methyl-4-(trideuteriomethyl)phenyl]-1-methyl-5-(trideuteriomethyl)pyridin-1-ium.
| Compound Name | 2-[5-(5,5-dimethylbenzo[b][1]benzosilol-3-yl)-2-methyl-4-(trideuteriomethyl)phenyl]-1-methyl-5-(trideuteriomethyl)pyridin-1-ium |
|---|---|
| PubChem CID | 166503326 |
| Molecular Formula | C29H30NSi+ |
| Molecular Weight | 426.69 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | 2-[5-(5,5-dimethylbenzo[b][1]benzosilol-3-yl)-2-methyl-4-(trideuteriomethyl)phenyl]-1-methyl-5-(trideuteriomethyl)pyridin-1-ium |
| SMILES | [2H]C([2H])([2H])c1ccc(-c2cc(-c3ccc4c(c3)[Si](C)(C)c3ccccc3-4)c(C([2H])([2H])[2H])cc2C)[n+](C)c1 |
| InChI | InChI=1S/C29H30NSi/c1-19-11-14-27(30(4)18-19)26-17-25(20(2)15-21(26)3)22-12-13-24-23-9-7-8-10-28(23)31(5,6)29(24)16-22/h7-18H,1-6H3/q+1/i1D3,2D3 |
| InChIKey | DOQOKZGODDKZLG-WFGJKAKNSA-N |
| XLogP | 5.57 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.69 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|