C32H32NY- — CID 140940716
1-methyl-2-(2,9,9,10,10-pentamethyl-6-phenyl-7H-phenanthren-7-id-1-yl)-5-(trideuteriomethyl)pyridin-1-ium;yttrium (PubChem CID 140940716) has the molecular formula C32H32NY- and a molecular weight of 522.54 g/mol. Its IUPAC name is 1-methyl-2-(2,9,9,10,10-pentamethyl-6-phenyl-7H-phenanthren-7-id-1-yl)-5-(trideuteriomethyl)pyridin-1-ium;yttrium.
| Compound Name | 1-methyl-2-(2,9,9,10,10-pentamethyl-6-phenyl-7H-phenanthren-7-id-1-yl)-5-(trideuteriomethyl)pyridin-1-ium;yttrium |
|---|---|
| PubChem CID | 140940716 |
| Molecular Formula | C32H32NY- |
| Molecular Weight | 522.54 g/mol |
| Exact Mass | 522.18 |
| IUPAC Name | 1-methyl-2-(2,9,9,10,10-pentamethyl-6-phenyl-7H-phenanthren-7-id-1-yl)-5-(trideuteriomethyl)pyridin-1-ium;yttrium |
| SMILES | [2H]C([2H])([2H])c1ccc(-c2c(C)ccc3c2C(C)(C)C(C)(C)c2c[c-]c(-c4[c-]cccc4)cc2-3)[n+](C)c1.[Y] |
| InChI | InChI=1S/C32H32N.Y/c1-21-13-18-28(33(7)20-21)29-22(2)14-16-25-26-19-24(23-11-9-8-10-12-23)15-17-27(26)31(3,4)32(5,6)30(25)29;/h8-11,13-14,16-20H,1-7H3;/q-1;/i1D3; |
| InChIKey | LWAKENIDVOEOJH-NIIDSAIPSA-N |
| XLogP | 7.30 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.54 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|