C41H37N2+ — CID 167400602
9-[3-(4-tert-butyl-1-methylpyridin-1-ium-2-yl)-4-methylphenyl]-1,8-diphenylcarbazole (PubChem CID 167400602) has the molecular formula C41H37N2+ and a molecular weight of 557.76 g/mol. Its IUPAC name is 9-[3-(4-tert-butyl-1-methylpyridin-1-ium-2-yl)-4-methylphenyl]-1,8-diphenylcarbazole.
| Compound Name | 9-[3-(4-tert-butyl-1-methylpyridin-1-ium-2-yl)-4-methylphenyl]-1,8-diphenylcarbazole |
|---|---|
| PubChem CID | 167400602 |
| Molecular Formula | C41H37N2+ |
| Molecular Weight | 557.76 g/mol |
| Exact Mass | 557.30 |
| IUPAC Name | 9-[3-(4-tert-butyl-1-methylpyridin-1-ium-2-yl)-4-methylphenyl]-1,8-diphenylcarbazole |
| SMILES | Cc1ccc(-n2c3c(-c4ccccc4)cccc3c3cccc(-c4ccccc4)c32)cc1-c1cc(C(C)(C)C)cc[n+]1C |
| InChI | InChI=1S/C41H37N2/c1-28-22-23-32(27-37(28)38-26-31(41(2,3)4)24-25-42(38)5)43-39-33(29-14-8-6-9-15-29)18-12-20-35(39)36-21-13-19-34(40(36)43)30-16-10-7-11-17-30/h6-27H,1-5H3/q+1 |
| InChIKey | XVKDHQHRMPIWBV-UHFFFAOYSA-N |
| XLogP | 10.22 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.76 |
| LogP ≤ 5 | 10.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|