C31H32N3+ — CID 167400606
1,8-dimethyl-9-[4-methyl-3-(1-methyl-4-pyrrolidin-1-ylpyridin-1-ium-2-yl)phenyl]carbazole (PubChem CID 167400606) has the molecular formula C31H32N3+ and a molecular weight of 446.62 g/mol. Its IUPAC name is 1,8-dimethyl-9-[4-methyl-3-(1-methyl-4-pyrrolidin-1-ylpyridin-1-ium-2-yl)phenyl]carbazole.
| Compound Name | 1,8-dimethyl-9-[4-methyl-3-(1-methyl-4-pyrrolidin-1-ylpyridin-1-ium-2-yl)phenyl]carbazole |
|---|---|
| PubChem CID | 167400606 |
| Molecular Formula | C31H32N3+ |
| Molecular Weight | 446.62 g/mol |
| Exact Mass | 446.26 |
| IUPAC Name | 1,8-dimethyl-9-[4-methyl-3-(1-methyl-4-pyrrolidin-1-ylpyridin-1-ium-2-yl)phenyl]carbazole |
| SMILES | Cc1ccc(-n2c3c(C)cccc3c3cccc(C)c32)cc1-c1cc(N2CCCC2)cc[n+]1C |
| InChI | InChI=1S/C31H32N3/c1-21-13-14-25(19-28(21)29-20-24(15-18-32(29)4)33-16-5-6-17-33)34-30-22(2)9-7-11-26(30)27-12-8-10-23(3)31(27)34/h7-15,18-20H,5-6,16-17H2,1-4H3/q+1 |
| InChIKey | CDZWEBPFOHNFQB-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 12.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.62 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|