C24H28N+ — CID 140777883
5-[4-(1,1-dideuterio-2,2-dimethylpropyl)phenyl]-1-methyl-2-(2-methylphenyl)pyridin-1-ium (PubChem CID 140777883) has the molecular formula C24H28N+ and a molecular weight of 332.51 g/mol. Its IUPAC name is 5-[4-(1,1-dideuterio-2,2-dimethylpropyl)phenyl]-1-methyl-2-(2-methylphenyl)pyridin-1-ium.
| Compound Name | 5-[4-(1,1-dideuterio-2,2-dimethylpropyl)phenyl]-1-methyl-2-(2-methylphenyl)pyridin-1-ium |
|---|---|
| PubChem CID | 140777883 |
| Molecular Formula | C24H28N+ |
| Molecular Weight | 332.51 g/mol |
| Exact Mass | 332.23 |
| IUPAC Name | 5-[4-(1,1-dideuterio-2,2-dimethylpropyl)phenyl]-1-methyl-2-(2-methylphenyl)pyridin-1-ium |
| SMILES | [2H]C([2H])(c1ccc(-c2ccc(-c3ccccc3C)[n+](C)c2)cc1)C(C)(C)C |
| InChI | InChI=1S/C24H28N/c1-18-8-6-7-9-22(18)23-15-14-21(17-25(23)5)20-12-10-19(11-13-20)16-24(2,3)4/h6-15,17H,16H2,1-5H3/q+1/i16D2 |
| InChIKey | WIMWECOEGVWLFU-BPPAMHLBSA-N |
| XLogP | 5.74 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.51 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|