C16H15N4+ — CID 58421094
2-[1-methyl-6-(2-methylphenyl)pyridin-1-ium-3-yl]-1,3,5-triazine (PubChem CID 58421094) has the molecular formula C16H15N4+ and a molecular weight of 263.32 g/mol. Its IUPAC name is 2-[1-methyl-6-(2-methylphenyl)pyridin-1-ium-3-yl]-1,3,5-triazine.
| Compound Name | 2-[1-methyl-6-(2-methylphenyl)pyridin-1-ium-3-yl]-1,3,5-triazine |
|---|---|
| PubChem CID | 58421094 |
| Molecular Formula | C16H15N4+ |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 2-[1-methyl-6-(2-methylphenyl)pyridin-1-ium-3-yl]-1,3,5-triazine |
| SMILES | Cc1ccccc1-c1ccc(-c2ncncn2)c[n+]1C |
| InChI | InChI=1S/C16H15N4/c1-12-5-3-4-6-14(12)15-8-7-13(9-20(15)2)16-18-10-17-11-19-16/h3-11H,1-2H3/q+1 |
| InChIKey | KFOLEYWWZLFJSV-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 42.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|