C21H24N3+ — CID 158344622
4-[1-methyl-6-(2-methylphenyl)pyridin-1-ium-3-yl]-2-(2,3,3,3-tetradeuterio-2-methylpropyl)pyrimidine (PubChem CID 158344622) has the molecular formula C21H24N3+ and a molecular weight of 322.47 g/mol. Its IUPAC name is 4-[1-methyl-6-(2-methylphenyl)pyridin-1-ium-3-yl]-2-(2,3,3,3-tetradeuterio-2-methylpropyl)pyrimidine.
| Compound Name | 4-[1-methyl-6-(2-methylphenyl)pyridin-1-ium-3-yl]-2-(2,3,3,3-tetradeuterio-2-methylpropyl)pyrimidine |
|---|---|
| PubChem CID | 158344622 |
| Molecular Formula | C21H24N3+ |
| Molecular Weight | 322.47 g/mol |
| Exact Mass | 322.22 |
| IUPAC Name | 4-[1-methyl-6-(2-methylphenyl)pyridin-1-ium-3-yl]-2-(2,3,3,3-tetradeuterio-2-methylpropyl)pyrimidine |
| SMILES | [2H]C([2H])([2H])C([2H])(C)Cc1nccc(-c2ccc(-c3ccccc3C)[n+](C)c2)n1 |
| InChI | InChI=1S/C21H24N3/c1-15(2)13-21-22-12-11-19(23-21)17-9-10-20(24(4)14-17)18-8-6-5-7-16(18)3/h5-12,14-15H,13H2,1-4H3/q+1/i1D3,15D |
| InChIKey | AROZRCOBPMNDQF-SZWUKCIMSA-N |
| XLogP | 4.14 |
| TPSA | 29.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.47 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|