C27H42N+ — CID 164945043
4,5-bis(1,1-dideuterio-2,2-dimethylpropyl)-2-[4-(1,1-dideuterio-2,2-dimethylpropyl)phenyl]-1-methylpyridin-1-ium (PubChem CID 164945043) has the molecular formula C27H42N+ and a molecular weight of 386.68 g/mol. Its IUPAC name is 4,5-bis(1,1-dideuterio-2,2-dimethylpropyl)-2-[4-(1,1-dideuterio-2,2-dimethylpropyl)phenyl]-1-methylpyridin-1-ium.
| Compound Name | 4,5-bis(1,1-dideuterio-2,2-dimethylpropyl)-2-[4-(1,1-dideuterio-2,2-dimethylpropyl)phenyl]-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 164945043 |
| Molecular Formula | C27H42N+ |
| Molecular Weight | 386.68 g/mol |
| Exact Mass | 386.37 |
| IUPAC Name | 4,5-bis(1,1-dideuterio-2,2-dimethylpropyl)-2-[4-(1,1-dideuterio-2,2-dimethylpropyl)phenyl]-1-methylpyridin-1-ium |
| SMILES | [2H]C([2H])(c1ccc(-c2cc(C([2H])([2H])C(C)(C)C)c(C([2H])([2H])C(C)(C)C)c[n+]2C)cc1)C(C)(C)C |
| InChI | InChI=1S/C27H42N/c1-25(2,3)16-20-11-13-21(14-12-20)24-15-22(17-26(4,5)6)23(19-28(24)10)18-27(7,8)9/h11-15,19H,16-18H2,1-10H3/q+1/i16D2,17D2,18D2 |
| InChIKey | ZCAKIPWCIIHFMN-UHKCGOEFSA-N |
| XLogP | 6.94 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.68 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|