C21H26N+ — CID 153452417
2-methyl-3-(2-methylphenyl)spiro[7,8-dihydro-6H-isoquinolin-2-ium-5,1'-cyclopentane] (PubChem CID 153452417) has the molecular formula C21H26N+ and a molecular weight of 292.45 g/mol. Its IUPAC name is 2-methyl-3-(2-methylphenyl)spiro[7,8-dihydro-6H-isoquinolin-2-ium-5,1'-cyclopentane].
| Compound Name | 2-methyl-3-(2-methylphenyl)spiro[7,8-dihydro-6H-isoquinolin-2-ium-5,1'-cyclopentane] |
|---|---|
| PubChem CID | 153452417 |
| Molecular Formula | C21H26N+ |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.21 |
| IUPAC Name | 2-methyl-3-(2-methylphenyl)spiro[7,8-dihydro-6H-isoquinolin-2-ium-5,1'-cyclopentane] |
| SMILES | Cc1ccccc1-c1cc2c(c[n+]1C)CCCC21CCCC1 |
| InChI | InChI=1S/C21H26N/c1-16-8-3-4-10-18(16)20-14-19-17(15-22(20)2)9-7-13-21(19)11-5-6-12-21/h3-4,8,10,14-15H,5-7,9,11-13H2,1-2H3/q+1 |
| InChIKey | MDKJNJJXCQMDCT-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|