C41H53N2OSi2+ — CID 172542680
6-[4-(2-deuteriopropan-2-yl)-1-methyl-5-trimethylsilylpyridin-1-ium-2-yl]-4-[4-[ditert-butyl(methyl)silyl]phenyl]-7-methyldibenzofuran-3-carbonitrile (PubChem CID 172542680) has the molecular formula C41H53N2OSi2+ and a molecular weight of 647.07 g/mol. Its IUPAC name is 6-[4-(2-deuteriopropan-2-yl)-1-methyl-5-trimethylsilylpyridin-1-ium-2-yl]-4-[4-[ditert-butyl(methyl)silyl]phenyl]-7-methyldibenzofuran-3-carbonitrile.
| Compound Name | 6-[4-(2-deuteriopropan-2-yl)-1-methyl-5-trimethylsilylpyridin-1-ium-2-yl]-4-[4-[ditert-butyl(methyl)silyl]phenyl]-7-methyldibenzofuran-3-carbonitrile |
|---|---|
| PubChem CID | 172542680 |
| Molecular Formula | C41H53N2OSi2+ |
| Molecular Weight | 647.07 g/mol |
| Exact Mass | 646.38 |
| IUPAC Name | 6-[4-(2-deuteriopropan-2-yl)-1-methyl-5-trimethylsilylpyridin-1-ium-2-yl]-4-[4-[ditert-butyl(methyl)silyl]phenyl]-7-methyldibenzofuran-3-carbonitrile |
| SMILES | [2H]C(C)(C)c1cc(-c2c(C)ccc3c2oc2c(-c4ccc([Si](C)(C(C)(C)C)C(C)(C)C)cc4)c(C#N)ccc23)[n+](C)cc1[Si](C)(C)C |
| InChI | InChI=1S/C41H53N2OSi2/c1-26(2)33-23-34(43(10)25-35(33)45(11,12)13)36-27(3)15-21-31-32-22-18-29(24-42)37(39(32)44-38(31)36)28-16-19-30(20-17-28)46(14,40(4,5)6)41(7,8)9/h15-23,25-26H,1-14H3/q+1/i26D |
| InChIKey | IEOPFZOMKHOGFF-HKAOEGRMSA-N |
| XLogP | 10.48 |
| TPSA | 40.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.07 |
| LogP ≤ 5 | 10.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|