C28H44NSi+ — CID 167357882
2-[6-[4-(2-cyclohexylpropan-2-yl)-2-methylphenyl]-1-methylpyridin-1-ium-3-yl]propan-2-yl-trimethylsilane (PubChem CID 167357882) has the molecular formula C28H44NSi+ and a molecular weight of 422.75 g/mol. Its IUPAC name is 2-[6-[4-(2-cyclohexylpropan-2-yl)-2-methylphenyl]-1-methylpyridin-1-ium-3-yl]propan-2-yl-trimethylsilane.
| Compound Name | 2-[6-[4-(2-cyclohexylpropan-2-yl)-2-methylphenyl]-1-methylpyridin-1-ium-3-yl]propan-2-yl-trimethylsilane |
|---|---|
| PubChem CID | 167357882 |
| Molecular Formula | C28H44NSi+ |
| Molecular Weight | 422.75 g/mol |
| Exact Mass | 422.32 |
| IUPAC Name | 2-[6-[4-(2-cyclohexylpropan-2-yl)-2-methylphenyl]-1-methylpyridin-1-ium-3-yl]propan-2-yl-trimethylsilane |
| SMILES | Cc1cc(C(C)(C)C2CCCCC2)ccc1-c1ccc(C(C)(C)[Si](C)(C)C)c[n+]1C |
| InChI | InChI=1S/C28H44NSi/c1-21-19-23(27(2,3)22-13-11-10-12-14-22)15-17-25(21)26-18-16-24(20-29(26)6)28(4,5)30(7,8)9/h15-20,22H,10-14H2,1-9H3/q+1 |
| InChIKey | AYYNYXWFGBPSDP-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.75 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|