C27H40N+ — CID 167357505
5-tert-butyl-1-methyl-2-[2-methyl-4-(1-methylcyclohexyl)phenyl]-4-propan-2-ylpyridin-1-ium (PubChem CID 167357505) has the molecular formula C27H40N+ and a molecular weight of 378.62 g/mol. Its IUPAC name is 5-tert-butyl-1-methyl-2-[2-methyl-4-(1-methylcyclohexyl)phenyl]-4-propan-2-ylpyridin-1-ium.
| Compound Name | 5-tert-butyl-1-methyl-2-[2-methyl-4-(1-methylcyclohexyl)phenyl]-4-propan-2-ylpyridin-1-ium |
|---|---|
| PubChem CID | 167357505 |
| Molecular Formula | C27H40N+ |
| Molecular Weight | 378.62 g/mol |
| Exact Mass | 378.32 |
| IUPAC Name | 5-tert-butyl-1-methyl-2-[2-methyl-4-(1-methylcyclohexyl)phenyl]-4-propan-2-ylpyridin-1-ium |
| SMILES | Cc1cc(C2(C)CCCCC2)ccc1-c1cc(C(C)C)c(C(C)(C)C)c[n+]1C |
| InChI | InChI=1S/C27H40N/c1-19(2)23-17-25(28(8)18-24(23)26(4,5)6)22-13-12-21(16-20(22)3)27(7)14-10-9-11-15-27/h12-13,16-19H,9-11,14-15H2,1-8H3/q+1 |
| InChIKey | QOWZBIAZMIBWEO-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.62 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|