C20H27FN+ — CID 172534914
5-tert-butyl-2-(4-fluoro-2-methylphenyl)-4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-1-methylpyridin-1-ium (PubChem CID 172534914) has the molecular formula C20H27FN+ and a molecular weight of 307.48 g/mol. Its IUPAC name is 5-tert-butyl-2-(4-fluoro-2-methylphenyl)-4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-1-methylpyridin-1-ium.
| Compound Name | 5-tert-butyl-2-(4-fluoro-2-methylphenyl)-4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 172534914 |
| Molecular Formula | C20H27FN+ |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.26 |
| IUPAC Name | 5-tert-butyl-2-(4-fluoro-2-methylphenyl)-4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-1-methylpyridin-1-ium |
| SMILES | [2H]C([2H])([2H])C([2H])(c1cc(-c2ccc(F)cc2C)[n+](C)cc1C(C)(C)C)C([2H])([2H])[2H] |
| InChI | InChI=1S/C20H27FN/c1-13(2)17-11-19(16-9-8-15(21)10-14(16)3)22(7)12-18(17)20(4,5)6/h8-13H,1-7H3/q+1/i1D3,2D3,13D |
| InChIKey | BNPPKJMWJBVVPJ-GYDXGMDDSA-N |
| XLogP | 5.05 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|