C16H21FNSi+ — CID 171723772
[4-deuterio-6-(4-fluoro-2-methylphenyl)-1-methylpyridin-1-ium-3-yl]-trimethylsilane (PubChem CID 171723772) has the molecular formula C16H21FNSi+ and a molecular weight of 275.44 g/mol. Its IUPAC name is [4-deuterio-6-(4-fluoro-2-methylphenyl)-1-methylpyridin-1-ium-3-yl]-trimethylsilane.
| Compound Name | [4-deuterio-6-(4-fluoro-2-methylphenyl)-1-methylpyridin-1-ium-3-yl]-trimethylsilane |
|---|---|
| PubChem CID | 171723772 |
| Molecular Formula | C16H21FNSi+ |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | [4-deuterio-6-(4-fluoro-2-methylphenyl)-1-methylpyridin-1-ium-3-yl]-trimethylsilane |
| SMILES | [2H]c1cc(-c2ccc(F)cc2C)[n+](C)cc1[Si](C)(C)C |
| InChI | InChI=1S/C16H21FNSi/c1-12-10-13(17)6-8-15(12)16-9-7-14(11-18(16)2)19(3,4)5/h6-11H,1-5H3/q+1/i7D |
| InChIKey | BRIPMBHLTFNHMI-WHRKIXHSSA-N |
| XLogP | 3.17 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|