C22H25FNSi+ — CID 167365287
[2-[4-fluoro-2-methyl-5-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-1-methylpyridin-1-ium-4-yl]-trimethylsilane (PubChem CID 167365287) has the molecular formula C22H25FNSi+ and a molecular weight of 355.56 g/mol. Its IUPAC name is [2-[4-fluoro-2-methyl-5-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-1-methylpyridin-1-ium-4-yl]-trimethylsilane.
| Compound Name | [2-[4-fluoro-2-methyl-5-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-1-methylpyridin-1-ium-4-yl]-trimethylsilane |
|---|---|
| PubChem CID | 167365287 |
| Molecular Formula | C22H25FNSi+ |
| Molecular Weight | 355.56 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | [2-[4-fluoro-2-methyl-5-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-1-methylpyridin-1-ium-4-yl]-trimethylsilane |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cc(-c3cc([Si](C)(C)C)cc[n+]3C)c(C)cc2F)c([2H])c1[2H] |
| InChI | InChI=1S/C22H25FNSi/c1-16-13-21(23)20(17-9-7-6-8-10-17)15-19(16)22-14-18(25(3,4)5)11-12-24(22)2/h6-15H,1-5H3/q+1/i6D,7D,8D,9D,10D |
| InChIKey | UWIDTPPVPPVLGX-AITMVNPLSA-N |
| XLogP | 4.84 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.56 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|