C19H18N+ — CID 166502950
1-methyl-2-[2-methyl-5-(2,3,4,5,6-pentadeuteriophenyl)phenyl]pyridin-1-ium (PubChem CID 166502950) has the molecular formula C19H18N+ and a molecular weight of 265.39 g/mol. Its IUPAC name is 1-methyl-2-[2-methyl-5-(2,3,4,5,6-pentadeuteriophenyl)phenyl]pyridin-1-ium.
| Compound Name | 1-methyl-2-[2-methyl-5-(2,3,4,5,6-pentadeuteriophenyl)phenyl]pyridin-1-ium |
|---|---|
| PubChem CID | 166502950 |
| Molecular Formula | C19H18N+ |
| Molecular Weight | 265.39 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | 1-methyl-2-[2-methyl-5-(2,3,4,5,6-pentadeuteriophenyl)phenyl]pyridin-1-ium |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc(C)c(-c3cccc[n+]3C)c2)c([2H])c1[2H] |
| InChI | InChI=1S/C19H18N/c1-15-11-12-17(16-8-4-3-5-9-16)14-18(15)19-10-6-7-13-20(19)2/h3-14H,1-2H3/q+1/i3D,4D,5D,8D,9D |
| InChIKey | CGQMIARWGUXXMP-YQYLVRRTSA-N |
| XLogP | 4.15 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.39 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|