C41H39N2O2+ — CID 177263966
4,18-ditert-butyl-11-[4-methyl-3-(1-methylpyridin-1-ium-2-yl)phenyl]-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene-8,14-dione (PubChem CID 177263966) has the molecular formula C41H39N2O2+ and a molecular weight of 591.78 g/mol. Its IUPAC name is 4,18-ditert-butyl-11-[4-methyl-3-(1-methylpyridin-1-ium-2-yl)phenyl]-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene-8,14-dione.
| Compound Name | 4,18-ditert-butyl-11-[4-methyl-3-(1-methylpyridin-1-ium-2-yl)phenyl]-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene-8,14-dione |
|---|---|
| PubChem CID | 177263966 |
| Molecular Formula | C41H39N2O2+ |
| Molecular Weight | 591.78 g/mol |
| Exact Mass | 591.30 |
| IUPAC Name | 4,18-ditert-butyl-11-[4-methyl-3-(1-methylpyridin-1-ium-2-yl)phenyl]-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene-8,14-dione |
| SMILES | Cc1ccc(-c2cc3c(=O)c4ccc(C(C)(C)C)cc4n4c5cc(C(C)(C)C)ccc5c(=O)c(c2)c34)cc1-c1cccc[n+]1C |
| InChI | InChI=1S/C41H39N2O2/c1-24-12-13-25(19-31(24)34-11-9-10-18-42(34)8)26-20-32-37-33(21-26)39(45)30-17-15-28(41(5,6)7)23-36(30)43(37)35-22-27(40(2,3)4)14-16-29(35)38(32)44/h9-23H,1-8H3/q+1 |
| InChIKey | WFLXOONMFOWAQP-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.78 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|