C32H36GeNO+ — CID 167358100
[4-(4-tert-butylphenyl)-7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-3-yl]-trimethylgermane (PubChem CID 167358100) has the molecular formula C32H36GeNO+ and a molecular weight of 523.26 g/mol. Its IUPAC name is [4-(4-tert-butylphenyl)-7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-3-yl]-trimethylgermane.
| Compound Name | [4-(4-tert-butylphenyl)-7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-3-yl]-trimethylgermane |
|---|---|
| PubChem CID | 167358100 |
| Molecular Formula | C32H36GeNO+ |
| Molecular Weight | 523.26 g/mol |
| Exact Mass | 524.20 |
| IUPAC Name | [4-(4-tert-butylphenyl)-7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-3-yl]-trimethylgermane |
| SMILES | Cc1ccc2c(oc3c(-c4ccc(C(C)(C)C)cc4)c([Ge](C)(C)C)ccc32)c1-c1cccc[n+]1C |
| InChI | InChI=1S/C32H36GeNO/c1-21-12-17-24-25-18-19-26(33(5,6)7)29(22-13-15-23(16-14-22)32(2,3)4)31(25)35-30(24)28(21)27-11-9-10-20-34(27)8/h9-20H,1-8H3/q+1 |
| InChIKey | ZPFGBMMNJNLAIM-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.26 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|