C24H24N3+ — CID 160779027
1-[4-(2-deuteriopropan-2-yl)-1-methylpyridin-1-ium-2-yl]-2-methyl-11H-indolo[1,2-a]benzimidazole (PubChem CID 160779027) has the molecular formula C24H24N3+ and a molecular weight of 355.48 g/mol. Its IUPAC name is 1-[4-(2-deuteriopropan-2-yl)-1-methylpyridin-1-ium-2-yl]-2-methyl-11H-indolo[1,2-a]benzimidazole.
| Compound Name | 1-[4-(2-deuteriopropan-2-yl)-1-methylpyridin-1-ium-2-yl]-2-methyl-11H-indolo[1,2-a]benzimidazole |
|---|---|
| PubChem CID | 160779027 |
| Molecular Formula | C24H24N3+ |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | 1-[4-(2-deuteriopropan-2-yl)-1-methylpyridin-1-ium-2-yl]-2-methyl-11H-indolo[1,2-a]benzimidazole |
| SMILES | [2H]C(C)(C)c1cc[n+](C)c(-c2c(C)ccc3c2Cc2nc4ccccc4n2-3)c1 |
| InChI | InChI=1S/C24H24N3/c1-15(2)17-11-12-26(4)22(13-17)24-16(3)9-10-20-18(24)14-23-25-19-7-5-6-8-21(19)27(20)23/h5-13,15H,14H2,1-4H3/q+1/i15D |
| InChIKey | OWLSUIFMMLGZQQ-RWFJLFJASA-N |
| XLogP | 4.85 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|