C22H21N4+ — CID 158388340
1-(3,6-dimethylpyrimidin-3-ium-4-yl)-2-methyl-3-(trideuteriomethyl)-11H-indolo[1,2-a]benzimidazole (PubChem CID 158388340) has the molecular formula C22H21N4+ and a molecular weight of 344.46 g/mol. Its IUPAC name is 1-(3,6-dimethylpyrimidin-3-ium-4-yl)-2-methyl-3-(trideuteriomethyl)-11H-indolo[1,2-a]benzimidazole.
| Compound Name | 1-(3,6-dimethylpyrimidin-3-ium-4-yl)-2-methyl-3-(trideuteriomethyl)-11H-indolo[1,2-a]benzimidazole |
|---|---|
| PubChem CID | 158388340 |
| Molecular Formula | C22H21N4+ |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | 1-(3,6-dimethylpyrimidin-3-ium-4-yl)-2-methyl-3-(trideuteriomethyl)-11H-indolo[1,2-a]benzimidazole |
| SMILES | [2H]C([2H])([2H])c1cc2c(c(-c3cc(C)nc[n+]3C)c1C)Cc1nc3ccccc3n1-2 |
| InChI | InChI=1S/C22H21N4/c1-13-9-19-16(11-21-24-17-7-5-6-8-18(17)26(19)21)22(15(13)3)20-10-14(2)23-12-25(20)4/h5-10,12H,11H2,1-4H3/q+1/i1D3 |
| InChIKey | SZJJEQIHPGGVDZ-FIBGUPNXSA-N |
| XLogP | 3.74 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|