C26H23N4+ — CID 159483407
9-(3,7-dimethylquinazolin-3-ium-4-yl)-8-methyl-7-(trideuteriomethyl)-11H-indolo[1,2-a]benzimidazole (PubChem CID 159483407) has the molecular formula C26H23N4+ and a molecular weight of 394.52 g/mol. Its IUPAC name is 9-(3,7-dimethylquinazolin-3-ium-4-yl)-8-methyl-7-(trideuteriomethyl)-11H-indolo[1,2-a]benzimidazole.
| Compound Name | 9-(3,7-dimethylquinazolin-3-ium-4-yl)-8-methyl-7-(trideuteriomethyl)-11H-indolo[1,2-a]benzimidazole |
|---|---|
| PubChem CID | 159483407 |
| Molecular Formula | C26H23N4+ |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | 9-(3,7-dimethylquinazolin-3-ium-4-yl)-8-methyl-7-(trideuteriomethyl)-11H-indolo[1,2-a]benzimidazole |
| SMILES | [2H]C([2H])([2H])c1cc2c(nc3n2-c2ccccc2C3)c(-c2c3ccc(C)cc3nc[n+]2C)c1C |
| InChI | InChI=1S/C26H23N4/c1-15-9-10-19-20(11-15)27-14-29(4)26(19)24-17(3)16(2)12-22-25(24)28-23-13-18-7-5-6-8-21(18)30(22)23/h5-12,14H,13H2,1-4H3/q+1/i2D3 |
| InChIKey | RFCLHHDDZBTCOR-BMSJAHLVSA-N |
| XLogP | 4.89 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|