C24H28N3+ — CID 158808145
5-[4-[cyclohexyl(dideuterio)methyl]-1-methylpyridin-1-ium-2-yl]-6-methyl-3H-pyrrolo[1,2-a]benzimidazole (PubChem CID 158808145) has the molecular formula C24H28N3+ and a molecular weight of 360.52 g/mol. Its IUPAC name is 5-[4-[cyclohexyl(dideuterio)methyl]-1-methylpyridin-1-ium-2-yl]-6-methyl-3H-pyrrolo[1,2-a]benzimidazole.
| Compound Name | 5-[4-[cyclohexyl(dideuterio)methyl]-1-methylpyridin-1-ium-2-yl]-6-methyl-3H-pyrrolo[1,2-a]benzimidazole |
|---|---|
| PubChem CID | 158808145 |
| Molecular Formula | C24H28N3+ |
| Molecular Weight | 360.52 g/mol |
| Exact Mass | 360.24 |
| IUPAC Name | 5-[4-[cyclohexyl(dideuterio)methyl]-1-methylpyridin-1-ium-2-yl]-6-methyl-3H-pyrrolo[1,2-a]benzimidazole |
| SMILES | [2H]C([2H])(c1cc[n+](C)c(-c2c(C)ccc3c2nc2n3C=CC2)c1)C1CCCCC1 |
| InChI | InChI=1S/C24H28N3/c1-17-10-11-20-24(25-22-9-6-13-27(20)22)23(17)21-16-19(12-14-26(21)2)15-18-7-4-3-5-8-18/h6,10-14,16,18H,3-5,7-9,15H2,1-2H3/q+1/i15D2 |
| InChIKey | LUHHJBPKUJGEKG-DOBBINOXSA-N |
| XLogP | 4.99 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.52 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|