C28H30N3+ — CID 158187633
9-[4-(cyclohexylmethyl)-1-methylpyridin-1-ium-2-yl]-8-methyl-13,16-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-1(10),2,4,6,8,12,14-heptaene (PubChem CID 158187633) has the molecular formula C28H30N3+ and a molecular weight of 408.57 g/mol. Its IUPAC name is 9-[4-(cyclohexylmethyl)-1-methylpyridin-1-ium-2-yl]-8-methyl-13,16-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-1(10),2,4,6,8,12,14-heptaene.
| Compound Name | 9-[4-(cyclohexylmethyl)-1-methylpyridin-1-ium-2-yl]-8-methyl-13,16-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-1(10),2,4,6,8,12,14-heptaene |
|---|---|
| PubChem CID | 158187633 |
| Molecular Formula | C28H30N3+ |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | 9-[4-(cyclohexylmethyl)-1-methylpyridin-1-ium-2-yl]-8-methyl-13,16-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-1(10),2,4,6,8,12,14-heptaene |
| SMILES | Cc1c(-c2cc(CC3CCCCC3)cc[n+]2C)c2c(c3ccccc13)-n1ccnc1C2 |
| InChI | InChI=1S/C28H30N3/c1-19-22-10-6-7-11-23(22)28-24(18-26-29-13-15-31(26)28)27(19)25-17-21(12-14-30(25)2)16-20-8-4-3-5-9-20/h6-7,10-15,17,20H,3-5,8-9,16,18H2,1-2H3/q+1 |
| InChIKey | KLUYCKUXYOWHHY-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|