C25H30N3+ — CID 158300959
7-[4-(cyclohexylmethyl)-1-methylpyridin-1-ium-2-yl]-2,6-dimethyl-3H-pyrrolo[1,2-a]benzimidazole (PubChem CID 158300959) has the molecular formula C25H30N3+ and a molecular weight of 372.54 g/mol. Its IUPAC name is 7-[4-(cyclohexylmethyl)-1-methylpyridin-1-ium-2-yl]-2,6-dimethyl-3H-pyrrolo[1,2-a]benzimidazole.
| Compound Name | 7-[4-(cyclohexylmethyl)-1-methylpyridin-1-ium-2-yl]-2,6-dimethyl-3H-pyrrolo[1,2-a]benzimidazole |
|---|---|
| PubChem CID | 158300959 |
| Molecular Formula | C25H30N3+ |
| Molecular Weight | 372.54 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | 7-[4-(cyclohexylmethyl)-1-methylpyridin-1-ium-2-yl]-2,6-dimethyl-3H-pyrrolo[1,2-a]benzimidazole |
| SMILES | CC1=Cn2c(nc3cc(C)c(-c4cc(CC5CCCCC5)cc[n+]4C)cc32)C1 |
| InChI | InChI=1S/C25H30N3/c1-17-11-25-26-22-12-18(2)21(15-24(22)28(25)16-17)23-14-20(9-10-27(23)3)13-19-7-5-4-6-8-19/h9-10,12,14-16,19H,4-8,11,13H2,1-3H3/q+1 |
| InChIKey | NUQPFXYQSDNBPG-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.54 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|