C24H22NO2+ — CID 163533390
trimethyl-[1-(6-methyl-9,14-dioxapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3(8),4,6,11,15,17,19-nonaen-7-yl)ethenyl]azanium (PubChem CID 163533390) has the molecular formula C24H22NO2+ and a molecular weight of 356.45 g/mol. Its IUPAC name is trimethyl-[1-(6-methyl-9,14-dioxapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3(8),4,6,11,15,17,19-nonaen-7-yl)ethenyl]azanium.
| Compound Name | trimethyl-[1-(6-methyl-9,14-dioxapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3(8),4,6,11,15,17,19-nonaen-7-yl)ethenyl]azanium |
|---|---|
| PubChem CID | 163533390 |
| Molecular Formula | C24H22NO2+ |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | trimethyl-[1-(6-methyl-9,14-dioxapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3(8),4,6,11,15,17,19-nonaen-7-yl)ethenyl]azanium |
| SMILES | C=C(c1c(C)ccc2c1oc1ccc3oc4ccccc4c3c12)[N+](C)(C)C |
| InChI | InChI=1S/C24H22NO2/c1-14-10-11-17-23-20(27-24(17)21(14)15(2)25(3,4)5)13-12-19-22(23)16-8-6-7-9-18(16)26-19/h6-13H,2H2,1,3-5H3/q+1 |
| InChIKey | BGFWMKKVLUSJLS-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|