C24H25N4O+ — CID 140828080
5-[1-(2,6-dimethylphenyl)-3-methylimidazol-3-ium-2-yl]-1,2,6-trimethyl-[1]benzofuro[2,3-d]imidazole (PubChem CID 140828080) has the molecular formula C24H25N4O+ and a molecular weight of 385.49 g/mol. Its IUPAC name is 5-[1-(2,6-dimethylphenyl)-3-methylimidazol-3-ium-2-yl]-1,2,6-trimethyl-[1]benzofuro[2,3-d]imidazole.
| Compound Name | 5-[1-(2,6-dimethylphenyl)-3-methylimidazol-3-ium-2-yl]-1,2,6-trimethyl-[1]benzofuro[2,3-d]imidazole |
|---|---|
| PubChem CID | 140828080 |
| Molecular Formula | C24H25N4O+ |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | 5-[1-(2,6-dimethylphenyl)-3-methylimidazol-3-ium-2-yl]-1,2,6-trimethyl-[1]benzofuro[2,3-d]imidazole |
| SMILES | Cc1cccc(C)c1-n1cc[n+](C)c1-c1c(C)ccc2c1oc1nc(C)n(C)c12 |
| InChI | InChI=1S/C24H25N4O/c1-14-10-11-18-21-23(25-17(4)27(21)6)29-22(18)19(14)24-26(5)12-13-28(24)20-15(2)8-7-9-16(20)3/h7-13H,1-6H3/q+1 |
| InChIKey | NSOKRZHVAXWFCJ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 39.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|