C22H20N3O2+ — CID 140827951
2,6-dimethyl-5-[1-methyl-3-(2-methylphenyl)imidazol-1-ium-2-yl]-[1]benzofuro[3,2-d][1,3]oxazole (PubChem CID 140827951) has the molecular formula C22H20N3O2+ and a molecular weight of 358.42 g/mol. Its IUPAC name is 2,6-dimethyl-5-[1-methyl-3-(2-methylphenyl)imidazol-1-ium-2-yl]-[1]benzofuro[3,2-d][1,3]oxazole.
| Compound Name | 2,6-dimethyl-5-[1-methyl-3-(2-methylphenyl)imidazol-1-ium-2-yl]-[1]benzofuro[3,2-d][1,3]oxazole |
|---|---|
| PubChem CID | 140827951 |
| Molecular Formula | C22H20N3O2+ |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 2,6-dimethyl-5-[1-methyl-3-(2-methylphenyl)imidazol-1-ium-2-yl]-[1]benzofuro[3,2-d][1,3]oxazole |
| SMILES | Cc1nc2c(o1)oc1c(-c3n(-c4ccccc4C)cc[n+]3C)c(C)ccc12 |
| InChI | InChI=1S/C22H20N3O2/c1-13-7-5-6-8-17(13)25-12-11-24(4)21(25)18-14(2)9-10-16-19-22(27-20(16)18)26-15(3)23-19/h5-12H,1-4H3/q+1 |
| InChIKey | UCCAAVNBNIFFJY-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 47.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|