C27H24N3S2+ — CID 140827575
14-[1-(2,6-dimethylphenyl)-3-methylimidazol-3-ium-2-yl]-5,13-dimethyl-8,16-dithia-6-azatetracyclo[7.7.0.02,7.010,15]hexadeca-1(9),2(7),3,5,10(15),11,13-heptaene (PubChem CID 140827575) has the molecular formula C27H24N3S2+ and a molecular weight of 454.64 g/mol. Its IUPAC name is 14-[1-(2,6-dimethylphenyl)-3-methylimidazol-3-ium-2-yl]-5,13-dimethyl-8,16-dithia-6-azatetracyclo[7.7.0.02,7.010,15]hexadeca-1(9),2(7),3,5,10(15),11,13-heptaene.
| Compound Name | 14-[1-(2,6-dimethylphenyl)-3-methylimidazol-3-ium-2-yl]-5,13-dimethyl-8,16-dithia-6-azatetracyclo[7.7.0.02,7.010,15]hexadeca-1(9),2(7),3,5,10(15),11,13-heptaene |
|---|---|
| PubChem CID | 140827575 |
| Molecular Formula | C27H24N3S2+ |
| Molecular Weight | 454.64 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | 14-[1-(2,6-dimethylphenyl)-3-methylimidazol-3-ium-2-yl]-5,13-dimethyl-8,16-dithia-6-azatetracyclo[7.7.0.02,7.010,15]hexadeca-1(9),2(7),3,5,10(15),11,13-heptaene |
| SMILES | Cc1ccc2c(n1)sc1c3ccc(C)c(-c4n(-c5c(C)cccc5C)cc[n+]4C)c3sc21 |
| InChI | InChI=1S/C27H24N3S2/c1-15-9-11-19-23(31-25-20-12-10-18(4)28-26(20)32-24(19)25)21(15)27-29(5)13-14-30(27)22-16(2)7-6-8-17(22)3/h6-14H,1-5H3/q+1 |
| InChIKey | WHWFDFJKHLBBOG-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.64 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|